C28H32N4O — CID 4700318
3-[3-(1-adamantyl)-1-phenylpyrazol-4-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile (PubChem CID 4700318) has the molecular formula C28H32N4O and a molecular weight of 440.59 g/mol. Its IUPAC name is 3-[3-(1-adamantyl)-1-phenylpyrazol-4-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | 3-[3-(1-adamantyl)-1-phenylpyrazol-4-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4700318 |
| Molecular Formula | C28H32N4O |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 3-[3-(1-adamantyl)-1-phenylpyrazol-4-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cn(-c2ccccc2)nc1C12CC3CC(CC(C3)C1)C2)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C28H32N4O/c29-18-23(27(33)31-9-5-2-6-10-31)14-24-19-32(25-7-3-1-4-8-25)30-26(24)28-15-20-11-21(16-28)13-22(12-20)17-28/h1,3-4,7-8,14,19-22H,2,5-6,9-13,15-17H2 |
| InChIKey | RNRSOMRHVZOWBU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|