C30H30N4O — CID 18806358
(Z)-3-[3-(1-adamantyl)-1-phenylpyrazol-4-yl]-N-benzyl-2-cyanoprop-2-enamide (PubChem CID 18806358) has the molecular formula C30H30N4O and a molecular weight of 462.60 g/mol. Its IUPAC name is (Z)-3-[3-(1-adamantyl)-1-phenylpyrazol-4-yl]-N-benzyl-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[3-(1-adamantyl)-1-phenylpyrazol-4-yl]-N-benzyl-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 18806358 |
| Molecular Formula | C30H30N4O |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | (Z)-3-[3-(1-adamantyl)-1-phenylpyrazol-4-yl]-N-benzyl-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/c1cn(-c2ccccc2)nc1C12CC3CC(CC(C3)C1)C2)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C30H30N4O/c31-18-25(29(35)32-19-21-7-3-1-4-8-21)14-26-20-34(27-9-5-2-6-10-27)33-28(26)30-15-22-11-23(16-30)13-24(12-22)17-30/h1-10,14,20,22-24H,11-13,15-17,19H2,(H,32,35)/b25-14- |
| InChIKey | QYZZHFXKZFKIBG-QFEZKATASA-N |
| XLogP | 5.56 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|