C17H21N3O3S — CID 47007559
4,5-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-1-(oxolan-2-ylmethyl)imidazole (PubChem CID 47007559) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 4,5-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-1-(oxolan-2-ylmethyl)imidazole.
| Compound Name | 4,5-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-1-(oxolan-2-ylmethyl)imidazole |
|---|---|
| PubChem CID | 47007559 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4,5-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-1-(oxolan-2-ylmethyl)imidazole |
| SMILES | Cc1nc(SCc2ccc([N+](=O)[O-])cc2)n(CC2CCCO2)c1C |
| InChI | InChI=1S/C17H21N3O3S/c1-12-13(2)19(10-16-4-3-9-23-16)17(18-12)24-11-14-5-7-15(8-6-14)20(21)22/h5-8,16H,3-4,9-11H2,1-2H3 |
| InChIKey | OXUAKBAAJQZDAD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|