C23H24Cl2FN3O3 — CID 47008105
N-(3-chloro-4-fluorophenyl)-2-[2-methoxy-4-[(2-pyridin-2-ylethylamino)methyl]phenoxy]acetamide;hydrochloride (PubChem CID 47008105) has the molecular formula C23H24Cl2FN3O3 and a molecular weight of 480.37 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[2-methoxy-4-[(2-pyridin-2-ylethylamino)methyl]phenoxy]acetamide;hydrochloride.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[2-methoxy-4-[(2-pyridin-2-ylethylamino)methyl]phenoxy]acetamide;hydrochloride |
|---|---|
| PubChem CID | 47008105 |
| Molecular Formula | C23H24Cl2FN3O3 |
| Molecular Weight | 480.37 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[2-methoxy-4-[(2-pyridin-2-ylethylamino)methyl]phenoxy]acetamide;hydrochloride |
| SMILES | COc1cc(CNCCc2ccccn2)ccc1OCC(=O)Nc1ccc(F)c(Cl)c1.Cl |
| InChI | InChI=1S/C23H23ClFN3O3.ClH/c1-30-22-12-16(14-26-11-9-17-4-2-3-10-27-17)5-8-21(22)31-15-23(29)28-18-6-7-20(25)19(24)13-18;/h2-8,10,12-13,26H,9,11,14-15H2,1H3,(H,28,29);1H |
| InChIKey | NFWNLSNOSBTVDO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|