C23H30ClN3O2S — CID 47011219
N-[2-(4-chlorophenyl)sulfanylethyl]-2-[[1-(4-methylphenyl)-2-morpholin-4-ylethyl]amino]acetamide (PubChem CID 47011219) has the molecular formula C23H30ClN3O2S and a molecular weight of 448.03 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-2-[[1-(4-methylphenyl)-2-morpholin-4-ylethyl]amino]acetamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-[[1-(4-methylphenyl)-2-morpholin-4-ylethyl]amino]acetamide |
|---|---|
| PubChem CID | 47011219 |
| Molecular Formula | C23H30ClN3O2S |
| Molecular Weight | 448.03 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-[[1-(4-methylphenyl)-2-morpholin-4-ylethyl]amino]acetamide |
| SMILES | Cc1ccc(C(CN2CCOCC2)NCC(=O)NCCSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H30ClN3O2S/c1-18-2-4-19(5-3-18)22(17-27-11-13-29-14-12-27)26-16-23(28)25-10-15-30-21-8-6-20(24)7-9-21/h2-9,22,26H,10-17H2,1H3,(H,25,28) |
| InChIKey | FPULPKBIZYTKSQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.03 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|