C16H22F2N2O4S — CID 47014013
ethyl 4-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]butanoate (PubChem CID 47014013) has the molecular formula C16H22F2N2O4S and a molecular weight of 376.43 g/mol. Its IUPAC name is ethyl 4-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]butanoate.
| Compound Name | ethyl 4-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 47014013 |
| Molecular Formula | C16H22F2N2O4S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | ethyl 4-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]butanoate |
| SMILES | CCOC(=O)CCCN1CCN(S(=O)(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C16H22F2N2O4S/c1-2-24-15(21)7-4-8-19-9-11-20(12-10-19)25(22,23)16-13(17)5-3-6-14(16)18/h3,5-6H,2,4,7-12H2,1H3 |
| InChIKey | QARBXDMFGKEBNK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |