C13H10ClF3N2O5S — CID 47016332
1-[2-(4-chlorophenyl)sulfonylethyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione (PubChem CID 47016332) has the molecular formula C13H10ClF3N2O5S and a molecular weight of 398.75 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfonylethyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[2-(4-chlorophenyl)sulfonylethyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 47016332 |
| Molecular Formula | C13H10ClF3N2O5S |
| Molecular Weight | 398.75 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfonylethyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(CC(F)(F)F)C(=O)N1CCS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H10ClF3N2O5S/c14-8-1-3-9(4-2-8)25(23,24)6-5-18-10(20)11(21)19(12(18)22)7-13(15,16)17/h1-4H,5-7H2 |
| InChIKey | NIJKACQDAZTCCM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.75 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|