C21H20ClN3O4 — CID 47017228
1-[3-(2-chloro-6,7-dimethoxyquinolin-3-yl)-5-(furan-2-yl)-3,4-dihydropyrazol-2-yl]propan-1-one (PubChem CID 47017228) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is 1-[3-(2-chloro-6,7-dimethoxyquinolin-3-yl)-5-(furan-2-yl)-3,4-dihydropyrazol-2-yl]propan-1-one.
| Compound Name | 1-[3-(2-chloro-6,7-dimethoxyquinolin-3-yl)-5-(furan-2-yl)-3,4-dihydropyrazol-2-yl]propan-1-one |
|---|---|
| PubChem CID | 47017228 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 1-[3-(2-chloro-6,7-dimethoxyquinolin-3-yl)-5-(furan-2-yl)-3,4-dihydropyrazol-2-yl]propan-1-one |
| SMILES | CCC(=O)N1N=C(c2ccco2)CC1c1cc2cc(OC)c(OC)cc2nc1Cl |
| InChI | InChI=1S/C21H20ClN3O4/c1-4-20(26)25-16(10-15(24-25)17-6-5-7-29-17)13-8-12-9-18(27-2)19(28-3)11-14(12)23-21(13)22/h5-9,11,16H,4,10H2,1-3H3 |
| InChIKey | KXJVVTABNNZTBR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 77.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|