C19H16Cl2FN5O — CID 47018817
(Z)-N-[(2,3-dichlorophenyl)methyl]-3-(4-fluorophenyl)-N-methyl-2-(5-methyltetrazol-1-yl)prop-2-enamide (PubChem CID 47018817) has the molecular formula C19H16Cl2FN5O and a molecular weight of 420.28 g/mol. Its IUPAC name is (Z)-N-[(2,3-dichlorophenyl)methyl]-3-(4-fluorophenyl)-N-methyl-2-(5-methyltetrazol-1-yl)prop-2-enamide.
| Compound Name | (Z)-N-[(2,3-dichlorophenyl)methyl]-3-(4-fluorophenyl)-N-methyl-2-(5-methyltetrazol-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 47018817 |
| Molecular Formula | C19H16Cl2FN5O |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | (Z)-N-[(2,3-dichlorophenyl)methyl]-3-(4-fluorophenyl)-N-methyl-2-(5-methyltetrazol-1-yl)prop-2-enamide |
| SMILES | Cc1nnnn1/C(=C\c1ccc(F)cc1)C(=O)N(C)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H16Cl2FN5O/c1-12-23-24-25-27(12)17(10-13-6-8-15(22)9-7-13)19(28)26(2)11-14-4-3-5-16(20)18(14)21/h3-10H,11H2,1-2H3/b17-10- |
| InChIKey | ALBXBUUTKXJJLA-YVLHZVERSA-N |
| XLogP | 4.08 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|