C22H23BrN2O3 — CID 47020581
1-[2-(4-bromobenzoyl)benzoyl]-N,N-dimethylpiperidine-4-carboxamide (PubChem CID 47020581) has the molecular formula C22H23BrN2O3 and a molecular weight of 443.34 g/mol. Its IUPAC name is 1-[2-(4-bromobenzoyl)benzoyl]-N,N-dimethylpiperidine-4-carboxamide.
| Compound Name | 1-[2-(4-bromobenzoyl)benzoyl]-N,N-dimethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 47020581 |
| Molecular Formula | C22H23BrN2O3 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 1-[2-(4-bromobenzoyl)benzoyl]-N,N-dimethylpiperidine-4-carboxamide |
| SMILES | CN(C)C(=O)C1CCN(C(=O)c2ccccc2C(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C22H23BrN2O3/c1-24(2)21(27)16-11-13-25(14-12-16)22(28)19-6-4-3-5-18(19)20(26)15-7-9-17(23)10-8-15/h3-10,16H,11-14H2,1-2H3 |
| InChIKey | JYYHPYHOGUFYLP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |