About 4-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]ethyl]benzenesulfonamide
4-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]ethyl]benzenesulfonamide (PubChem CID 47020602) has the molecular formula C15H21N3O2S2
and a molecular weight of 339.49 g/mol. Its IUPAC name is 4-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]ethyl]benzenesulfonamide |
| PubChem CID | 47020602 |
| Molecular Formula | C15H21N3O2S2 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 4-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]ethyl]benzenesulfonamide |
| SMILES | CCc1nc(CN(C)C(C)c2ccc(S(N)(=O)=O)cc2)cs1 |
| InChI | InChI=1S/C15H21N3O2S2/c1-4-15-17-13(10-21-15)9-18(3)11(2)12-5-7-14(8-6-12)22(16,19)20/h5-8,10-11H,4,9H2,1-3H3,(H2,16,19,20) |
| InChIKey | REJJFSUSEYCNRK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]ethyl]benzenesulfonamide?
The IUPAC name of 4-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]ethyl]benzenesulfonamide (CID 47020602) is 4-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]ethyl]benzenesulfonamide.
What is the SMILES notation for 4-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]ethyl]benzenesulfonamide?
The canonical SMILES for 4-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]ethyl]benzenesulfonamide is CCc1nc(CN(C)C(C)c2ccc(S(N)(=O)=O)cc2)cs1.
What is the InChIKey of 4-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]ethyl]benzenesulfonamide?
The InChIKey is REJJFSUSEYCNRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O2S2/c1-4-15-17-13(10-21-15)9-18(3)11(2)12-5-7-14(8-6-12)22(16,19)20/h5-8,10-11H,4,9H2,1-3H3,(H2,16,19,20).
What are the key properties of 4-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]ethyl]benzenesulfonamide?
4-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]ethyl]benzenesulfonamide has a molecular weight of 339.49 g/mol, XLogP of 2.55, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]ethyl]benzenesulfonamide is sourced from PubChem (CID 47020602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).