C22H17N3OS — CID 47023138
7-methyl-2-[[3-(2-thiophen-2-ylethynyl)anilino]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 47023138) has the molecular formula C22H17N3OS and a molecular weight of 371.47 g/mol. Its IUPAC name is 7-methyl-2-[[3-(2-thiophen-2-ylethynyl)anilino]methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 7-methyl-2-[[3-(2-thiophen-2-ylethynyl)anilino]methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 47023138 |
| Molecular Formula | C22H17N3OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 7-methyl-2-[[3-(2-thiophen-2-ylethynyl)anilino]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1ccc2nc(CNc3cccc(C#Cc4cccs4)c3)cc(=O)n2c1 |
| InChI | InChI=1S/C22H17N3OS/c1-16-7-10-21-24-19(13-22(26)25(21)15-16)14-23-18-5-2-4-17(12-18)8-9-20-6-3-11-27-20/h2-7,10-13,15,23H,14H2,1H3 |
| InChIKey | ITOHOQSUIWRFRE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|