C16H18N4OS — CID 47024547
N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-1H-indazole-7-carboxamide (PubChem CID 47024547) has the molecular formula C16H18N4OS and a molecular weight of 314.41 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-1H-indazole-7-carboxamide.
| Compound Name | N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 47024547 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-1H-indazole-7-carboxamide |
| SMILES | CN(C)C(CNC(=O)c1cccc2cn[nH]c12)c1ccsc1 |
| InChI | InChI=1S/C16H18N4OS/c1-20(2)14(12-6-7-22-10-12)9-17-16(21)13-5-3-4-11-8-18-19-15(11)13/h3-8,10,14H,9H2,1-2H3,(H,17,21)(H,18,19) |
| InChIKey | OXVHXCCJISZRNB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |