C20H22N2OS3 — CID 30856572
N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]-2-(thiophen-3-ylmethylsulfanyl)benzamide (PubChem CID 30856572) has the molecular formula C20H22N2OS3 and a molecular weight of 402.61 g/mol. Its IUPAC name is N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]-2-(thiophen-3-ylmethylsulfanyl)benzamide.
| Compound Name | N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]-2-(thiophen-3-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 30856572 |
| Molecular Formula | C20H22N2OS3 |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]-2-(thiophen-3-ylmethylsulfanyl)benzamide |
| SMILES | CN(C)[C@@H](CNC(=O)c1ccccc1SCc1ccsc1)c1ccsc1 |
| InChI | InChI=1S/C20H22N2OS3/c1-22(2)18(16-8-10-25-14-16)11-21-20(23)17-5-3-4-6-19(17)26-13-15-7-9-24-12-15/h3-10,12,14,18H,11,13H2,1-2H3,(H,21,23)/t18-/m0/s1 |
| InChIKey | GHOXPHHJSCVQSQ-SFHVURJKSA-N |
| XLogP | 5.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |