C18H24N2OS2 — CID 51958555
(2R)-2-benzylsulfanyl-N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]propanamide (PubChem CID 51958555) has the molecular formula C18H24N2OS2 and a molecular weight of 348.54 g/mol. Its IUPAC name is (2R)-2-benzylsulfanyl-N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]propanamide.
| Compound Name | (2R)-2-benzylsulfanyl-N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]propanamide |
|---|---|
| PubChem CID | 51958555 |
| Molecular Formula | C18H24N2OS2 |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (2R)-2-benzylsulfanyl-N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]propanamide |
| SMILES | C[C@@H](SCc1ccccc1)C(=O)NC[C@@H](c1ccsc1)N(C)C |
| InChI | InChI=1S/C18H24N2OS2/c1-14(23-12-15-7-5-4-6-8-15)18(21)19-11-17(20(2)3)16-9-10-22-13-16/h4-10,13-14,17H,11-12H2,1-3H3,(H,19,21)/t14-,17+/m1/s1 |
| InChIKey | YSXYSFVUGHAGII-PBHICJAKSA-N |
| XLogP | 3.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |