C18H17NO2S — CID 47024674
4-(benzylsulfinylmethyl)-2-(4-methylphenyl)-1,3-oxazole (PubChem CID 47024674) has the molecular formula C18H17NO2S and a molecular weight of 311.41 g/mol. Its IUPAC name is 4-(benzylsulfinylmethyl)-2-(4-methylphenyl)-1,3-oxazole.
| Compound Name | 4-(benzylsulfinylmethyl)-2-(4-methylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 47024674 |
| Molecular Formula | C18H17NO2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 4-(benzylsulfinylmethyl)-2-(4-methylphenyl)-1,3-oxazole |
| SMILES | Cc1ccc(-c2nc(CS(=O)Cc3ccccc3)co2)cc1 |
| InChI | InChI=1S/C18H17NO2S/c1-14-7-9-16(10-8-14)18-19-17(11-21-18)13-22(20)12-15-5-3-2-4-6-15/h2-11H,12-13H2,1H3 |
| InChIKey | AZWOYBFFXWPZAQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |