C16H13F2N3O4S — CID 47026821
2,4-difluoro-N-[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]benzenesulfonamide (PubChem CID 47026821) has the molecular formula C16H13F2N3O4S and a molecular weight of 381.36 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 47026821 |
| Molecular Formula | C16H13F2N3O4S |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 2,4-difluoro-N-[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]benzenesulfonamide |
| SMILES | CC1(c2ccc(NS(=O)(=O)c3ccc(F)cc3F)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C16H13F2N3O4S/c1-16(14(22)19-15(23)20-16)9-2-5-11(6-3-9)21-26(24,25)13-7-4-10(17)8-12(13)18/h2-8,21H,1H3,(H2,19,20,22,23) |
| InChIKey | CXZHQPWCOPRAKQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|