C20H21FN4O4 — CID 47035344
1-(4-fluorophenyl)-5-[4-(6-nitro-3-pyridinyl)piperazin-1-yl]pentane-1,5-dione (PubChem CID 47035344) has the molecular formula C20H21FN4O4 and a molecular weight of 400.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-[4-(6-nitro-3-pyridinyl)piperazin-1-yl]pentane-1,5-dione.
| Compound Name | 1-(4-fluorophenyl)-5-[4-(6-nitro-3-pyridinyl)piperazin-1-yl]pentane-1,5-dione |
|---|---|
| PubChem CID | 47035344 |
| Molecular Formula | C20H21FN4O4 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-(4-fluorophenyl)-5-[4-(6-nitro-3-pyridinyl)piperazin-1-yl]pentane-1,5-dione |
| SMILES | O=C(CCCC(=O)N1CCN(c2ccc([N+](=O)[O-])nc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN4O4/c21-16-6-4-15(5-7-16)18(26)2-1-3-20(27)24-12-10-23(11-13-24)17-8-9-19(22-14-17)25(28)29/h4-9,14H,1-3,10-13H2 |
| InChIKey | OVQCDUGKBSGWNA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|