C28H29N5O4S — CID 4703582
4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-[3-(3-methylbutoxy)phenyl]-1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 4703582) has the molecular formula C28H29N5O4S and a molecular weight of 531.64 g/mol. Its IUPAC name is 4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-[3-(3-methylbutoxy)phenyl]-1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-[3-(3-methylbutoxy)phenyl]-1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4703582 |
| Molecular Formula | C28H29N5O4S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-[3-(3-methylbutoxy)phenyl]-1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | Cc1nnc(N2C(=O)C(=O)C(=C(O)c3nc4c(C)cccn4c3C)C2c2cccc(OCCC(C)C)c2)s1 |
| InChI | InChI=1S/C28H29N5O4S/c1-15(2)11-13-37-20-10-6-9-19(14-20)23-21(25(35)27(36)33(23)28-31-30-18(5)38-28)24(34)22-17(4)32-12-7-8-16(3)26(32)29-22/h6-10,12,14-15,23,34H,11,13H2,1-5H3 |
| InChIKey | PTYJHLVRCTZLJH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 109.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|