C30H30N4O6S — CID 4702922
methyl 2-[2-(3-butoxyphenyl)-3-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4702922) has the molecular formula C30H30N4O6S and a molecular weight of 574.66 g/mol. Its IUPAC name is methyl 2-[2-(3-butoxyphenyl)-3-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[2-(3-butoxyphenyl)-3-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4702922 |
| Molecular Formula | C30H30N4O6S |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | methyl 2-[2-(3-butoxyphenyl)-3-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCOc1cccc(C2C(=C(O)c3nc4c(C)cccn4c3C)C(=O)C(=O)N2c2nc(C)c(C(=O)OC)s2)c1 |
| InChI | InChI=1S/C30H30N4O6S/c1-6-7-14-40-20-12-8-11-19(15-20)23-21(24(35)22-18(4)33-13-9-10-16(2)27(33)32-22)25(36)28(37)34(23)30-31-17(3)26(41-30)29(38)39-5/h8-13,15,23,35H,6-7,14H2,1-5H3 |
| InChIKey | HQHMCMJGISATPO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|