C32H34N4O6S — CID 6194457
(4E)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6194457) has the molecular formula C32H34N4O6S and a molecular weight of 602.71 g/mol. Its IUPAC name is (4E)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6194457 |
| Molecular Formula | C32H34N4O6S |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | (4E)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(C2/C(=C(\O)c3nc4c(C)cccn4c3C)C(=O)C(=O)N2c2nc(C)c(C(C)=O)s2)cc1OC |
| InChI | InChI=1S/C32H34N4O6S/c1-7-8-9-15-42-22-13-12-21(16-23(22)41-6)26-24(27(38)25-19(4)35-14-10-11-17(2)30(35)34-25)28(39)31(40)36(26)32-33-18(3)29(43-32)20(5)37/h10-14,16,26,38H,7-9,15H2,1-6H3/b27-24+ |
| InChIKey | XEHDURFVXCMTNV-SOYKGTTHSA-N |
| XLogP | 6.12 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|