C34H36N4O7S — CID 6194371
prop-2-enyl 2-[(3E)-3-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-2-[3-methoxy-4-(3-methylbutoxy)phenyl]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 6194371) has the molecular formula C34H36N4O7S and a molecular weight of 644.75 g/mol. Its IUPAC name is prop-2-enyl 2-[(3E)-3-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-2-[3-methoxy-4-(3-methylbutoxy)phenyl]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[(3E)-3-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-2-[3-methoxy-4-(3-methylbutoxy)phenyl]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 6194371 |
| Molecular Formula | C34H36N4O7S |
| Molecular Weight | 644.75 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | prop-2-enyl 2-[(3E)-3-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-2-[3-methoxy-4-(3-methylbutoxy)phenyl]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3nc4c(C)cccn4c3C)C2c2ccc(OCCC(C)C)c(OC)c2)nc1C |
| InChI | InChI=1S/C34H36N4O7S/c1-8-15-45-33(42)30-20(5)35-34(46-30)38-27(22-11-12-23(24(17-22)43-7)44-16-13-18(2)3)25(29(40)32(38)41)28(39)26-21(6)37-14-9-10-19(4)31(37)36-26/h8-12,14,17-18,27,39H,1,13,15-16H2,2-7H3/b28-25+ |
| InChIKey | AHSOMBFAAJQVDB-AZPGRJICSA-N |
| XLogP | 6.12 |
| TPSA | 132.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.75 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|