C34H38N4O7S — CID 6194342
ethyl 2-[(3E)-3-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-2-(3-ethoxy-4-pentoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 6194342) has the molecular formula C34H38N4O7S and a molecular weight of 646.77 g/mol. Its IUPAC name is ethyl 2-[(3E)-3-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-2-(3-ethoxy-4-pentoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(3E)-3-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-2-(3-ethoxy-4-pentoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 6194342 |
| Molecular Formula | C34H38N4O7S |
| Molecular Weight | 646.77 g/mol |
| Exact Mass | 646.25 |
| IUPAC Name | ethyl 2-[(3E)-3-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-2-(3-ethoxy-4-pentoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCOc1ccc(C2/C(=C(\O)c3nc4c(C)cccn4c3C)C(=O)C(=O)N2c2nc(C)c(C(=O)OCC)s2)cc1OCC |
| InChI | InChI=1S/C34H38N4O7S/c1-7-10-11-17-45-23-15-14-22(18-24(23)43-8-2)27-25(28(39)26-21(6)37-16-12-13-19(4)31(37)36-26)29(40)32(41)38(27)34-35-20(5)30(46-34)33(42)44-9-3/h12-16,18,27,39H,7-11,17H2,1-6H3/b28-25+ |
| InChIKey | CMKPQNMGBKPBPN-AZPGRJICSA-N |
| XLogP | 6.49 |
| TPSA | 132.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.77 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|