C35H36N4O5S — CID 6195201
(4E)-5-(4-butoxy-3-ethoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]pyrrolidine-2,3-dione (PubChem CID 6195201) has the molecular formula C35H36N4O5S and a molecular weight of 624.76 g/mol. Its IUPAC name is (4E)-5-(4-butoxy-3-ethoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-butoxy-3-ethoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6195201 |
| Molecular Formula | C35H36N4O5S |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | (4E)-5-(4-butoxy-3-ethoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]pyrrolidine-2,3-dione |
| SMILES | CCCCOc1ccc(C2/C(=C(\O)c3nc4c(C)cccn4c3C)C(=O)C(=O)N2c2nc3c(C)cc(C)cc3s2)cc1OCC |
| InChI | InChI=1S/C35H36N4O5S/c1-7-9-15-44-24-13-12-23(18-25(24)43-8-2)30-27(31(40)29-22(6)38-14-10-11-20(4)33(38)36-29)32(41)34(42)39(30)35-37-28-21(5)16-19(3)17-26(28)45-35/h10-14,16-18,30,40H,7-9,15H2,1-6H3/b31-27+ |
| InChIKey | RMUFMYBZQKTWOT-TVKQRKNISA-N |
| XLogP | 7.38 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|