C30H26N4O5S — CID 6195170
(4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(4-hydroxy-3-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6195170) has the molecular formula C30H26N4O5S and a molecular weight of 554.63 g/mol. Its IUPAC name is (4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(4-hydroxy-3-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(4-hydroxy-3-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6195170 |
| Molecular Formula | C30H26N4O5S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | (4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(4-hydroxy-3-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(\O)c3nc4c(C)cccn4c3C)C(=O)C(=O)N2c2nc3c(C)cc(C)cc3s2)ccc1O |
| InChI | InChI=1S/C30H26N4O5S/c1-14-11-16(3)23-21(12-14)40-30(32-23)34-25(18-8-9-19(35)20(13-18)39-5)22(27(37)29(34)38)26(36)24-17(4)33-10-6-7-15(2)28(33)31-24/h6-13,25,35-36H,1-5H3/b26-22+ |
| InChIKey | TZXAKEPPENLUIK-XTCLZLMSSA-N |
| XLogP | 5.52 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|