C33H32N4O4S — CID 6195192
(4E)-5-(3-butoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]pyrrolidine-2,3-dione (PubChem CID 6195192) has the molecular formula C33H32N4O4S and a molecular weight of 580.71 g/mol. Its IUPAC name is (4E)-5-(3-butoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3-butoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6195192 |
| Molecular Formula | C33H32N4O4S |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | (4E)-5-(3-butoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]pyrrolidine-2,3-dione |
| SMILES | CCCCOc1cccc(C2/C(=C(\O)c3nc4c(C)cccn4c3C)C(=O)C(=O)N2c2nc3c(C)cc(C)cc3s2)c1 |
| InChI | InChI=1S/C33H32N4O4S/c1-6-7-14-41-23-12-8-11-22(17-23)28-25(29(38)27-21(5)36-13-9-10-19(3)31(36)34-27)30(39)32(40)37(28)33-35-26-20(4)15-18(2)16-24(26)42-33/h8-13,15-17,28,38H,6-7,14H2,1-5H3/b29-25+ |
| InChIKey | DCAKHXLOWZHIAZ-XLVZBRSZSA-N |
| XLogP | 6.98 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|