C18H10F3N3OS — CID 47036921
3-cyano-N-[5-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 47036921) has the molecular formula C18H10F3N3OS and a molecular weight of 373.36 g/mol. Its IUPAC name is 3-cyano-N-[5-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3-cyano-N-[5-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 47036921 |
| Molecular Formula | C18H10F3N3OS |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 3-cyano-N-[5-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | N#Cc1cccc(C(=O)Nc2ncc(Cc3ccc(F)c(F)c3F)s2)c1 |
| InChI | InChI=1S/C18H10F3N3OS/c19-14-5-4-11(15(20)16(14)21)7-13-9-23-18(26-13)24-17(25)12-3-1-2-10(6-12)8-22/h1-6,9H,7H2,(H,23,24,25) |
| InChIKey | ABUZLEJPWGJOAM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|