C20H17FN4O3 — CID 47038981
1-[2-(2-cyano-3-fluoroanilino)ethyl]-3-(4-methyl-2-oxochromen-7-yl)urea (PubChem CID 47038981) has the molecular formula C20H17FN4O3 and a molecular weight of 380.38 g/mol. Its IUPAC name is 1-[2-(2-cyano-3-fluoroanilino)ethyl]-3-(4-methyl-2-oxochromen-7-yl)urea.
| Compound Name | 1-[2-(2-cyano-3-fluoroanilino)ethyl]-3-(4-methyl-2-oxochromen-7-yl)urea |
|---|---|
| PubChem CID | 47038981 |
| Molecular Formula | C20H17FN4O3 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-[2-(2-cyano-3-fluoroanilino)ethyl]-3-(4-methyl-2-oxochromen-7-yl)urea |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)NCCNc3cccc(F)c3C#N)ccc12 |
| InChI | InChI=1S/C20H17FN4O3/c1-12-9-19(26)28-18-10-13(5-6-14(12)18)25-20(27)24-8-7-23-17-4-2-3-16(21)15(17)11-22/h2-6,9-10,23H,7-8H2,1H3,(H2,24,25,27) |
| InChIKey | NSHHPMWDSUTJNM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|