C19H16N4O3 — CID 134146093
3-[(5-cyano-2-pyridinyl)amino]-N-(4-methyl-2-oxochromen-7-yl)propanamide (PubChem CID 134146093) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is 3-[(5-cyano-2-pyridinyl)amino]-N-(4-methyl-2-oxochromen-7-yl)propanamide.
| Compound Name | 3-[(5-cyano-2-pyridinyl)amino]-N-(4-methyl-2-oxochromen-7-yl)propanamide |
|---|---|
| PubChem CID | 134146093 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 3-[(5-cyano-2-pyridinyl)amino]-N-(4-methyl-2-oxochromen-7-yl)propanamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)CCNc3ccc(C#N)cn3)ccc12 |
| InChI | InChI=1S/C19H16N4O3/c1-12-8-19(25)26-16-9-14(3-4-15(12)16)23-18(24)6-7-21-17-5-2-13(10-20)11-22-17/h2-5,8-9,11H,6-7H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | PCLLJYYBZVBSSB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|