C21H26N6OS — CID 47041210
1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-(2-pyrazol-1-yl-3-pyridinyl)urea (PubChem CID 47041210) has the molecular formula C21H26N6OS and a molecular weight of 410.55 g/mol. Its IUPAC name is 1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-(2-pyrazol-1-yl-3-pyridinyl)urea.
| Compound Name | 1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-(2-pyrazol-1-yl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 47041210 |
| Molecular Formula | C21H26N6OS |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-(2-pyrazol-1-yl-3-pyridinyl)urea |
| SMILES | CC1CCN(C(CNC(=O)Nc2cccnc2-n2cccn2)c2cccs2)CC1 |
| InChI | InChI=1S/C21H26N6OS/c1-16-7-12-26(13-8-16)18(19-6-3-14-29-19)15-23-21(28)25-17-5-2-9-22-20(17)27-11-4-10-24-27/h2-6,9-11,14,16,18H,7-8,12-13,15H2,1H3,(H2,23,25,28) |
| InChIKey | NIHVAVKVMLDUBV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |