C18H17N3O3 — CID 47041297
1-(furan-3-ylmethyl)-3-[3-(pyridin-4-ylmethoxy)phenyl]urea (PubChem CID 47041297) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 1-(furan-3-ylmethyl)-3-[3-(pyridin-4-ylmethoxy)phenyl]urea.
| Compound Name | 1-(furan-3-ylmethyl)-3-[3-(pyridin-4-ylmethoxy)phenyl]urea |
|---|---|
| PubChem CID | 47041297 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-(furan-3-ylmethyl)-3-[3-(pyridin-4-ylmethoxy)phenyl]urea |
| SMILES | O=C(NCc1ccoc1)Nc1cccc(OCc2ccncc2)c1 |
| InChI | InChI=1S/C18H17N3O3/c22-18(20-11-15-6-9-23-12-15)21-16-2-1-3-17(10-16)24-13-14-4-7-19-8-5-14/h1-10,12H,11,13H2,(H2,20,21,22) |
| InChIKey | HYVQGOSVAKCLOS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |