C17H20N4O2S — CID 47044392
N'-(4-methylsulfanylphenyl)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)oxamide (PubChem CID 47044392) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is N'-(4-methylsulfanylphenyl)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)oxamide.
| Compound Name | N'-(4-methylsulfanylphenyl)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)oxamide |
|---|---|
| PubChem CID | 47044392 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N'-(4-methylsulfanylphenyl)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)oxamide |
| SMILES | CSc1ccc(NC(=O)C(=O)NC2CCCc3c2cnn3C)cc1 |
| InChI | InChI=1S/C17H20N4O2S/c1-21-15-5-3-4-14(13(15)10-18-21)20-17(23)16(22)19-11-6-8-12(24-2)9-7-11/h6-10,14H,3-5H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | KUAMKTGNRRYLMG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|