C21H28N4O2S — CID 86881140
N'-(4-tert-butylsulfanyl-2-methylphenyl)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)oxamide (PubChem CID 86881140) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is N'-(4-tert-butylsulfanyl-2-methylphenyl)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)oxamide.
| Compound Name | N'-(4-tert-butylsulfanyl-2-methylphenyl)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)oxamide |
|---|---|
| PubChem CID | 86881140 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N'-(4-tert-butylsulfanyl-2-methylphenyl)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)oxamide |
| SMILES | Cc1cc(SC(C)(C)C)ccc1NC(=O)C(=O)NC1CCCc2c1cnn2C |
| InChI | InChI=1S/C21H28N4O2S/c1-13-11-14(28-21(2,3)4)9-10-16(13)23-19(26)20(27)24-17-7-6-8-18-15(17)12-22-25(18)5/h9-12,17H,6-8H2,1-5H3,(H,23,26)(H,24,27) |
| InChIKey | XSHRWGJQEHSZSC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|