C22H22N2O3S — CID 47046962
[3-(benzenesulfonylmethyl)phenyl]-(2-propan-2-ylimino-1-pyridinyl)methanone (PubChem CID 47046962) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is [3-(benzenesulfonylmethyl)phenyl]-(2-propan-2-ylimino-1-pyridinyl)methanone.
| Compound Name | [3-(benzenesulfonylmethyl)phenyl]-(2-propan-2-ylimino-1-pyridinyl)methanone |
|---|---|
| PubChem CID | 47046962 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [3-(benzenesulfonylmethyl)phenyl]-(2-propan-2-ylimino-1-pyridinyl)methanone |
| SMILES | CC(C)/N=c1\ccccn1C(=O)c1cccc(CS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H22N2O3S/c1-17(2)23-21-13-6-7-14-24(21)22(25)19-10-8-9-18(15-19)16-28(26,27)20-11-4-3-5-12-20/h3-15,17H,16H2,1-2H3/b23-21+ |
| InChIKey | OEOXCSQKOJOMMN-XTQSDGFTSA-N |
| XLogP | 3.46 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |