C23H21N5O2 — CID 47047959
N'-[2-(1H-indol-3-yl)acetyl]-6-(N-methylanilino)pyridine-3-carbohydrazide (PubChem CID 47047959) has the molecular formula C23H21N5O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is N'-[2-(1H-indol-3-yl)acetyl]-6-(N-methylanilino)pyridine-3-carbohydrazide.
| Compound Name | N'-[2-(1H-indol-3-yl)acetyl]-6-(N-methylanilino)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 47047959 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N'-[2-(1H-indol-3-yl)acetyl]-6-(N-methylanilino)pyridine-3-carbohydrazide |
| SMILES | CN(c1ccccc1)c1ccc(C(=O)NNC(=O)Cc2c[nH]c3ccccc23)cn1 |
| InChI | InChI=1S/C23H21N5O2/c1-28(18-7-3-2-4-8-18)21-12-11-16(14-25-21)23(30)27-26-22(29)13-17-15-24-20-10-6-5-9-19(17)20/h2-12,14-15,24H,13H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | OEKGBYWVXQRPMI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|