C18H20N6O — CID 47048736
1-(3-pyrazol-1-ylphenyl)-3-[3-(pyridin-2-ylamino)propyl]urea (PubChem CID 47048736) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 1-(3-pyrazol-1-ylphenyl)-3-[3-(pyridin-2-ylamino)propyl]urea.
| Compound Name | 1-(3-pyrazol-1-ylphenyl)-3-[3-(pyridin-2-ylamino)propyl]urea |
|---|---|
| PubChem CID | 47048736 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 1-(3-pyrazol-1-ylphenyl)-3-[3-(pyridin-2-ylamino)propyl]urea |
| SMILES | O=C(NCCCNc1ccccn1)Nc1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C18H20N6O/c25-18(21-11-4-10-20-17-8-1-2-9-19-17)23-15-6-3-7-16(14-15)24-13-5-12-22-24/h1-3,5-9,12-14H,4,10-11H2,(H,19,20)(H2,21,23,25) |
| InChIKey | JREGPAHMRUBHIE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|