C20H22N4O3 — CID 55746297
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-pyrazol-1-ylphenyl)urea (PubChem CID 55746297) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-pyrazol-1-ylphenyl)urea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-pyrazol-1-ylphenyl)urea |
|---|---|
| PubChem CID | 55746297 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-pyrazol-1-ylphenyl)urea |
| SMILES | COc1ccc(CCNC(=O)Nc2cccc(-n3cccn3)c2)cc1OC |
| InChI | InChI=1S/C20H22N4O3/c1-26-18-8-7-15(13-19(18)27-2)9-11-21-20(25)23-16-5-3-6-17(14-16)24-12-4-10-22-24/h3-8,10,12-14H,9,11H2,1-2H3,(H2,21,23,25) |
| InChIKey | KOCXABVIZDOFJK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |