C19H16N4O3 — CID 47048861
3-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]-1-phenylimidazolidine-2,4-dione (PubChem CID 47048861) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is 3-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]-1-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]-1-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 47048861 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 3-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]-1-phenylimidazolidine-2,4-dione |
| SMILES | Cc1cccc(-c2nc(CN3C(=O)CN(c4ccccc4)C3=O)no2)c1 |
| InChI | InChI=1S/C19H16N4O3/c1-13-6-5-7-14(10-13)18-20-16(21-26-18)11-23-17(24)12-22(19(23)25)15-8-3-2-4-9-15/h2-10H,11-12H2,1H3 |
| InChIKey | TYAAGAIKPAHUDD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|