C16H16N4O3S — CID 42960204
3-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 42960204) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is 3-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 42960204 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 3-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | Cc1cccc(-c2nc(CN3C(=O)NC4(CCSC4)C3=O)no2)c1 |
| InChI | InChI=1S/C16H16N4O3S/c1-10-3-2-4-11(7-10)13-17-12(19-23-13)8-20-14(21)16(18-15(20)22)5-6-24-9-16/h2-4,7H,5-6,8-9H2,1H3,(H,18,22) |
| InChIKey | RTWBESYPEQLNOP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|