C17H21FN4O3S — CID 47050503
1-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-(2-fluoro-5-nitrophenyl)urea (PubChem CID 47050503) has the molecular formula C17H21FN4O3S and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-(2-fluoro-5-nitrophenyl)urea.
| Compound Name | 1-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-(2-fluoro-5-nitrophenyl)urea |
|---|---|
| PubChem CID | 47050503 |
| Molecular Formula | C17H21FN4O3S |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-(2-fluoro-5-nitrophenyl)urea |
| SMILES | CCN(CC)C(CNC(=O)Nc1cc([N+](=O)[O-])ccc1F)c1ccsc1 |
| InChI | InChI=1S/C17H21FN4O3S/c1-3-21(4-2)16(12-7-8-26-11-12)10-19-17(23)20-15-9-13(22(24)25)5-6-14(15)18/h5-9,11,16H,3-4,10H2,1-2H3,(H2,19,20,23) |
| InChIKey | CLEGDSPROWVTAM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|