C19H23N3O3S — CID 60567757
(E)-N-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 60567757) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is (E)-N-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 60567757 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (E)-N-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CCN(CC)C(CNC(=O)/C=C/c1ccc([N+](=O)[O-])cc1)c1ccsc1 |
| InChI | InChI=1S/C19H23N3O3S/c1-3-21(4-2)18(16-11-12-26-14-16)13-20-19(23)10-7-15-5-8-17(9-6-15)22(24)25/h5-12,14,18H,3-4,13H2,1-2H3,(H,20,23)/b10-7+ |
| InChIKey | BNVXGRKSDRFTRT-JXMROGBWSA-N |
| XLogP | 3.87 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|