C18H26N6O — CID 47051831
1-(1-ethylpyrazol-4-yl)-3-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]urea (PubChem CID 47051831) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is 1-(1-ethylpyrazol-4-yl)-3-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]urea.
| Compound Name | 1-(1-ethylpyrazol-4-yl)-3-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 47051831 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-(1-ethylpyrazol-4-yl)-3-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]urea |
| SMILES | CCn1cc(NC(=O)Nc2ccc(N3CCN(C)CC3)cc2C)cn1 |
| InChI | InChI=1S/C18H26N6O/c1-4-24-13-15(12-19-24)20-18(25)21-17-6-5-16(11-14(17)2)23-9-7-22(3)8-10-23/h5-6,11-13H,4,7-10H2,1-3H3,(H2,20,21,25) |
| InChIKey | MJEWUEKMMBKNON-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|