C19H25N3O2S — CID 47052619
3-morpholin-4-yl-N-[3-[(thiophen-2-ylmethylamino)methyl]phenyl]propanamide (PubChem CID 47052619) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is 3-morpholin-4-yl-N-[3-[(thiophen-2-ylmethylamino)methyl]phenyl]propanamide.
| Compound Name | 3-morpholin-4-yl-N-[3-[(thiophen-2-ylmethylamino)methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 47052619 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 3-morpholin-4-yl-N-[3-[(thiophen-2-ylmethylamino)methyl]phenyl]propanamide |
| SMILES | O=C(CCN1CCOCC1)Nc1cccc(CNCc2cccs2)c1 |
| InChI | InChI=1S/C19H25N3O2S/c23-19(6-7-22-8-10-24-11-9-22)21-17-4-1-3-16(13-17)14-20-15-18-5-2-12-25-18/h1-5,12-13,20H,6-11,14-15H2,(H,21,23) |
| InChIKey | YHWBUZNJIMGHHZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |