C19H22ClN5O4 — CID 47052940
5-chloro-N-[1-(furan-3-carbonyl)piperidin-4-yl]-2-morpholin-4-ylpyrimidine-4-carboxamide (PubChem CID 47052940) has the molecular formula C19H22ClN5O4 and a molecular weight of 419.87 g/mol. Its IUPAC name is 5-chloro-N-[1-(furan-3-carbonyl)piperidin-4-yl]-2-morpholin-4-ylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-[1-(furan-3-carbonyl)piperidin-4-yl]-2-morpholin-4-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 47052940 |
| Molecular Formula | C19H22ClN5O4 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 5-chloro-N-[1-(furan-3-carbonyl)piperidin-4-yl]-2-morpholin-4-ylpyrimidine-4-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccoc2)CC1)c1nc(N2CCOCC2)ncc1Cl |
| InChI | InChI=1S/C19H22ClN5O4/c20-15-11-21-19(25-6-9-28-10-7-25)23-16(15)17(26)22-14-1-4-24(5-2-14)18(27)13-3-8-29-12-13/h3,8,11-12,14H,1-2,4-7,9-10H2,(H,22,26) |
| InChIKey | QDIQMGMNXNLQOD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |