C20H24N4O4 — CID 38215093
N-[1-(furan-3-carbonyl)piperidin-4-yl]-2-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 38215093) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-[1-(furan-3-carbonyl)piperidin-4-yl]-2-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | N-[1-(furan-3-carbonyl)piperidin-4-yl]-2-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 38215093 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-[1-(furan-3-carbonyl)piperidin-4-yl]-2-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccoc2)CC1)c1cccnc1N1CCOCC1 |
| InChI | InChI=1S/C20H24N4O4/c25-19(17-2-1-6-21-18(17)23-9-12-27-13-10-23)22-16-3-7-24(8-4-16)20(26)15-5-11-28-14-15/h1-2,5-6,11,14,16H,3-4,7-10,12-13H2,(H,22,25) |
| InChIKey | TWCFQNAVVJRAJG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |