C19H25N3O3S2 — CID 47055897
N-[2-(4-sulfamoylphenyl)ethyl]-2-(2-thiophen-3-ylpyrrolidin-1-yl)propanamide (PubChem CID 47055897) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[2-(4-sulfamoylphenyl)ethyl]-2-(2-thiophen-3-ylpyrrolidin-1-yl)propanamide.
| Compound Name | N-[2-(4-sulfamoylphenyl)ethyl]-2-(2-thiophen-3-ylpyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 47055897 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[2-(4-sulfamoylphenyl)ethyl]-2-(2-thiophen-3-ylpyrrolidin-1-yl)propanamide |
| SMILES | CC(C(=O)NCCc1ccc(S(N)(=O)=O)cc1)N1CCCC1c1ccsc1 |
| InChI | InChI=1S/C19H25N3O3S2/c1-14(22-11-2-3-18(22)16-9-12-26-13-16)19(23)21-10-8-15-4-6-17(7-5-15)27(20,24)25/h4-7,9,12-14,18H,2-3,8,10-11H2,1H3,(H,21,23)(H2,20,24,25) |
| InChIKey | PKKLOVRVTFARJH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |