C20H28FN3O3 — CID 47056403
N-[4-fluoro-3-(2-oxopyrrolidin-1-yl)phenyl]-3-methyl-2-(3-methylbutanoylamino)butanamide (PubChem CID 47056403) has the molecular formula C20H28FN3O3 and a molecular weight of 377.46 g/mol. Its IUPAC name is N-[4-fluoro-3-(2-oxopyrrolidin-1-yl)phenyl]-3-methyl-2-(3-methylbutanoylamino)butanamide.
| Compound Name | N-[4-fluoro-3-(2-oxopyrrolidin-1-yl)phenyl]-3-methyl-2-(3-methylbutanoylamino)butanamide |
|---|---|
| PubChem CID | 47056403 |
| Molecular Formula | C20H28FN3O3 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-[4-fluoro-3-(2-oxopyrrolidin-1-yl)phenyl]-3-methyl-2-(3-methylbutanoylamino)butanamide |
| SMILES | CC(C)CC(=O)NC(C(=O)Nc1ccc(F)c(N2CCCC2=O)c1)C(C)C |
| InChI | InChI=1S/C20H28FN3O3/c1-12(2)10-17(25)23-19(13(3)4)20(27)22-14-7-8-15(21)16(11-14)24-9-5-6-18(24)26/h7-8,11-13,19H,5-6,9-10H2,1-4H3,(H,22,27)(H,23,25) |
| InChIKey | WREMOPNSDNTPFV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |