C17H16N2O5S — CID 47056723
N,N-dimethyl-2-[4-[(E)-3-(5-nitrothiophen-3-yl)prop-2-enoyl]phenoxy]acetamide (PubChem CID 47056723) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[(E)-3-(5-nitrothiophen-3-yl)prop-2-enoyl]phenoxy]acetamide.
| Compound Name | N,N-dimethyl-2-[4-[(E)-3-(5-nitrothiophen-3-yl)prop-2-enoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 47056723 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N,N-dimethyl-2-[4-[(E)-3-(5-nitrothiophen-3-yl)prop-2-enoyl]phenoxy]acetamide |
| SMILES | CN(C)C(=O)COc1ccc(C(=O)/C=C/c2csc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H16N2O5S/c1-18(2)16(21)10-24-14-6-4-13(5-7-14)15(20)8-3-12-9-17(19(22)23)25-11-12/h3-9,11H,10H2,1-2H3/b8-3+ |
| InChIKey | CMJOZGJIQYEDRZ-FPYGCLRLSA-N |
| XLogP | 3.02 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|