C18H27Cl2N3O — CID 47060513
N-[(2-chloro-8-methylquinolin-3-yl)methyl]-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine;hydrochloride (PubChem CID 47060513) has the molecular formula C18H27Cl2N3O and a molecular weight of 372.34 g/mol. Its IUPAC name is N-[(2-chloro-8-methylquinolin-3-yl)methyl]-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine;hydrochloride.
| Compound Name | N-[(2-chloro-8-methylquinolin-3-yl)methyl]-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 47060513 |
| Molecular Formula | C18H27Cl2N3O |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-[(2-chloro-8-methylquinolin-3-yl)methyl]-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine;hydrochloride |
| SMILES | COCCN(C)CCCNCc1cc2cccc(C)c2nc1Cl.Cl |
| InChI | InChI=1S/C18H26ClN3O.ClH/c1-14-6-4-7-15-12-16(18(19)21-17(14)15)13-20-8-5-9-22(2)10-11-23-3;/h4,6-7,12,20H,5,8-11,13H2,1-3H3;1H |
| InChIKey | MTEFCYJWDHYMGK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|