C16H21NO6S — CID 47065116
methyl 4-(1,4-dioxaspiro[4.5]decan-8-ylsulfamoyl)benzoate (PubChem CID 47065116) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is methyl 4-(1,4-dioxaspiro[4.5]decan-8-ylsulfamoyl)benzoate.
| Compound Name | methyl 4-(1,4-dioxaspiro[4.5]decan-8-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 47065116 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | methyl 4-(1,4-dioxaspiro[4.5]decan-8-ylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC2CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C16H21NO6S/c1-21-15(18)12-2-4-14(5-3-12)24(19,20)17-13-6-8-16(9-7-13)22-10-11-23-16/h2-5,13,17H,6-11H2,1H3 |
| InChIKey | OGYWSHCGDBJQRP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |